About [4-(cyclohexen-1-yl)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)but-3-yn-2-yl] methyl carbonate
[4-(cyclohexen-1-yl)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)but-3-yn-2-yl] methyl carbonate (PubChem CID 10913863) has the molecular formula C17H24O5
and a molecular weight of 308.37 g/mol. Its IUPAC name is [4-(cyclohexen-1-yl)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)but-3-yn-2-yl] methyl carbonate.
Molecular Properties
| Compound Name | [4-(cyclohexen-1-yl)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)but-3-yn-2-yl] methyl carbonate |
| PubChem CID | 10913863 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [4-(cyclohexen-1-yl)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)but-3-yn-2-yl] methyl carbonate |
| SMILES | COC(=O)OC(C#CC1=CCCCC1)CC1COC(C)(C)O1 |
| InChI | InChI=1S/C17H24O5/c1-17(2)20-12-15(22-17)11-14(21-16(18)19-3)10-9-13-7-5-4-6-8-13/h7,14-15H,4-6,8,11-12H2,1-3H3 |
| InChIKey | SUBIWMOHGODLIB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(cyclohexen-1-yl)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)but-3-yn-2-yl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(cyclohexen-1-yl)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)but-3-yn-2-yl] methyl carbonate?
The IUPAC name of [4-(cyclohexen-1-yl)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)but-3-yn-2-yl] methyl carbonate (CID 10913863) is [4-(cyclohexen-1-yl)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)but-3-yn-2-yl] methyl carbonate.
What is the SMILES notation for [4-(cyclohexen-1-yl)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)but-3-yn-2-yl] methyl carbonate?
The canonical SMILES for [4-(cyclohexen-1-yl)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)but-3-yn-2-yl] methyl carbonate is COC(=O)OC(C#CC1=CCCCC1)CC1COC(C)(C)O1.
What is the InChIKey of [4-(cyclohexen-1-yl)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)but-3-yn-2-yl] methyl carbonate?
The InChIKey is SUBIWMOHGODLIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O5/c1-17(2)20-12-15(22-17)11-14(21-16(18)19-3)10-9-13-7-5-4-6-8-13/h7,14-15H,4-6,8,11-12H2,1-3H3.
What are the key properties of [4-(cyclohexen-1-yl)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)but-3-yn-2-yl] methyl carbonate?
[4-(cyclohexen-1-yl)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)but-3-yn-2-yl] methyl carbonate has a molecular weight of 308.37 g/mol, XLogP of 3.18, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(cyclohexen-1-yl)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)but-3-yn-2-yl] methyl carbonate is sourced from PubChem (CID 10913863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).