C15H19NO4S — CID 10913893
(6S,7R,7aS)-6-(benzenesulfonyl)-3,3,7-trimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 10913893) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is (6S,7R,7aS)-6-(benzenesulfonyl)-3,3,7-trimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (6S,7R,7aS)-6-(benzenesulfonyl)-3,3,7-trimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 10913893 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (6S,7R,7aS)-6-(benzenesulfonyl)-3,3,7-trimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | C[C@@H]1[C@H]2COC(C)(C)N2C(=O)[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H19NO4S/c1-10-12-9-20-15(2,3)16(12)14(17)13(10)21(18,19)11-7-5-4-6-8-11/h4-8,10,12-13H,9H2,1-3H3/t10-,12-,13+/m1/s1 |
| InChIKey | VEDQXVHERKBACL-RTXFEEFZSA-N |
| XLogP | 1.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |