C23H27N3O3 — CID 109139044
2-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-N-(3-methylphenyl)cyclopropane-1-carboxamide (PubChem CID 109139044) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-N-(3-methylphenyl)cyclopropane-1-carboxamide.
| Compound Name | 2-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-N-(3-methylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 109139044 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-N-(3-methylphenyl)cyclopropane-1-carboxamide |
| SMILES | COc1ccccc1N1CCN(C(=O)C2CC2C(=O)Nc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C23H27N3O3/c1-16-6-5-7-17(14-16)24-22(27)18-15-19(18)23(28)26-12-10-25(11-13-26)20-8-3-4-9-21(20)29-2/h3-9,14,18-19H,10-13,15H2,1-2H3,(H,24,27) |
| InChIKey | IBFOQDHFOGMIFP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |