C15H20N2O2 — CID 109139586
1-N-tert-butyl-2-N-phenylcyclopropane-1,2-dicarboxamide (PubChem CID 109139586) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-N-tert-butyl-2-N-phenylcyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-tert-butyl-2-N-phenylcyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109139586 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 1-N-tert-butyl-2-N-phenylcyclopropane-1,2-dicarboxamide |
| SMILES | CC(C)(C)NC(=O)C1CC1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H20N2O2/c1-15(2,3)17-14(19)12-9-11(12)13(18)16-10-7-5-4-6-8-10/h4-8,11-12H,9H2,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | ACCKXJJGWKLDJO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |