C12H16N4O6 — CID 10913963
dimethyl 6,8-dimethyl-5,7-dioxo-1,2,3,4-tetrahydropyrimido[4,5-c]pyridazine-3,4-dicarboxylate (PubChem CID 10913963) has the molecular formula C12H16N4O6 and a molecular weight of 312.28 g/mol. Its IUPAC name is dimethyl 6,8-dimethyl-5,7-dioxo-1,2,3,4-tetrahydropyrimido[4,5-c]pyridazine-3,4-dicarboxylate.
| Compound Name | dimethyl 6,8-dimethyl-5,7-dioxo-1,2,3,4-tetrahydropyrimido[4,5-c]pyridazine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 10913963 |
| Molecular Formula | C12H16N4O6 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | dimethyl 6,8-dimethyl-5,7-dioxo-1,2,3,4-tetrahydropyrimido[4,5-c]pyridazine-3,4-dicarboxylate |
| SMILES | COC(=O)C1NNc2c(c(=O)n(C)c(=O)n2C)C1C(=O)OC |
| InChI | InChI=1S/C12H16N4O6/c1-15-8-6(9(17)16(2)12(15)20)5(10(18)21-3)7(13-14-8)11(19)22-4/h5,7,13-14H,1-4H3 |
| InChIKey | PVZYSOQQCHCGTK-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |