C6H18O3Si3 — CID 10914
2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 10914) has the molecular formula C6H18O3Si3 and a molecular weight of 222.46 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 10914 |
| Molecular Formula | C6H18O3Si3 |
| Molecular Weight | 222.46 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C6H18O3Si3/c1-10(2)7-11(3,4)9-12(5,6)8-10/h1-6H3 |
| InChIKey | HTDJPCNNEPUOOQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|