About 2-benzyl-2-hydroxy-5,7-dimethoxy-3H-chromen-4-one
2-benzyl-2-hydroxy-5,7-dimethoxy-3H-chromen-4-one (PubChem CID 10914018) has the molecular formula C18H18O5
and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-benzyl-2-hydroxy-5,7-dimethoxy-3H-chromen-4-one.
Molecular Properties
| Compound Name | 2-benzyl-2-hydroxy-5,7-dimethoxy-3H-chromen-4-one |
| PubChem CID | 10914018 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-benzyl-2-hydroxy-5,7-dimethoxy-3H-chromen-4-one |
| SMILES | COc1cc(OC)c2c(c1)OC(O)(Cc1ccccc1)CC2=O |
| InChI | InChI=1S/C18H18O5/c1-21-13-8-15(22-2)17-14(19)11-18(20,23-16(17)9-13)10-12-6-4-3-5-7-12/h3-9,20H,10-11H2,1-2H3 |
| InChIKey | ANVJZXRKBUCXDZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-benzyl-2-hydroxy-5,7-dimethoxy-3H-chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-2-hydroxy-5,7-dimethoxy-3H-chromen-4-one?
The IUPAC name of 2-benzyl-2-hydroxy-5,7-dimethoxy-3H-chromen-4-one (CID 10914018) is 2-benzyl-2-hydroxy-5,7-dimethoxy-3H-chromen-4-one.
What is the SMILES notation for 2-benzyl-2-hydroxy-5,7-dimethoxy-3H-chromen-4-one?
The canonical SMILES for 2-benzyl-2-hydroxy-5,7-dimethoxy-3H-chromen-4-one is COc1cc(OC)c2c(c1)OC(O)(Cc1ccccc1)CC2=O.
What is the InChIKey of 2-benzyl-2-hydroxy-5,7-dimethoxy-3H-chromen-4-one?
The InChIKey is ANVJZXRKBUCXDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O5/c1-21-13-8-15(22-2)17-14(19)11-18(20,23-16(17)9-13)10-12-6-4-3-5-7-12/h3-9,20H,10-11H2,1-2H3.
What are the key properties of 2-benzyl-2-hydroxy-5,7-dimethoxy-3H-chromen-4-one?
2-benzyl-2-hydroxy-5,7-dimethoxy-3H-chromen-4-one has a molecular weight of 314.34 g/mol, XLogP of 2.60, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-2-hydroxy-5,7-dimethoxy-3H-chromen-4-one is sourced from PubChem (CID 10914018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).