About 1-[(1S,2S)-2-methoxy-2-(2-methoxypent-4-enyl)cyclopentyl]sulfanyl-4-methylbenzene
1-[(1S,2S)-2-methoxy-2-(2-methoxypent-4-enyl)cyclopentyl]sulfanyl-4-methylbenzene (PubChem CID 10914201) has the molecular formula C19H28O2S
and a molecular weight of 320.50 g/mol. Its IUPAC name is 1-[(1S,2S)-2-methoxy-2-(2-methoxypent-4-enyl)cyclopentyl]sulfanyl-4-methylbenzene.
Molecular Properties
| Compound Name | 1-[(1S,2S)-2-methoxy-2-(2-methoxypent-4-enyl)cyclopentyl]sulfanyl-4-methylbenzene |
| PubChem CID | 10914201 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 1-[(1S,2S)-2-methoxy-2-(2-methoxypent-4-enyl)cyclopentyl]sulfanyl-4-methylbenzene |
| SMILES | C=CCC(C[C@@]1(OC)CCC[C@@H]1Sc1ccc(C)cc1)OC |
| InChI | InChI=1S/C19H28O2S/c1-5-7-16(20-3)14-19(21-4)13-6-8-18(19)22-17-11-9-15(2)10-12-17/h5,9-12,16,18H,1,6-8,13-14H2,2-4H3/t16?,18-,19-/m0/s1 |
| InChIKey | GHWSZZASURTTKA-MSYFUGIWSA-N |
| XLogP | 5.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1S,2S)-2-methoxy-2-(2-methoxypent-4-enyl)cyclopentyl]sulfanyl-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2S)-2-methoxy-2-(2-methoxypent-4-enyl)cyclopentyl]sulfanyl-4-methylbenzene?
The IUPAC name of 1-[(1S,2S)-2-methoxy-2-(2-methoxypent-4-enyl)cyclopentyl]sulfanyl-4-methylbenzene (CID 10914201) is 1-[(1S,2S)-2-methoxy-2-(2-methoxypent-4-enyl)cyclopentyl]sulfanyl-4-methylbenzene.
What is the SMILES notation for 1-[(1S,2S)-2-methoxy-2-(2-methoxypent-4-enyl)cyclopentyl]sulfanyl-4-methylbenzene?
The canonical SMILES for 1-[(1S,2S)-2-methoxy-2-(2-methoxypent-4-enyl)cyclopentyl]sulfanyl-4-methylbenzene is C=CCC(C[C@@]1(OC)CCC[C@@H]1Sc1ccc(C)cc1)OC.
What is the InChIKey of 1-[(1S,2S)-2-methoxy-2-(2-methoxypent-4-enyl)cyclopentyl]sulfanyl-4-methylbenzene?
The InChIKey is GHWSZZASURTTKA-MSYFUGIWSA-N. The full InChI is InChI=1S/C19H28O2S/c1-5-7-16(20-3)14-19(21-4)13-6-8-18(19)22-17-11-9-15(2)10-12-17/h5,9-12,16,18H,1,6-8,13-14H2,2-4H3/t16?,18-,19-/m0/s1.
What are the key properties of 1-[(1S,2S)-2-methoxy-2-(2-methoxypent-4-enyl)cyclopentyl]sulfanyl-4-methylbenzene?
1-[(1S,2S)-2-methoxy-2-(2-methoxypent-4-enyl)cyclopentyl]sulfanyl-4-methylbenzene has a molecular weight of 320.50 g/mol, XLogP of 5.01, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2S)-2-methoxy-2-(2-methoxypent-4-enyl)cyclopentyl]sulfanyl-4-methylbenzene is sourced from PubChem (CID 10914201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).