C23H26N2O3 — CID 109142489
2-N-(3-acetylphenyl)-1-N-(2,6-diethylphenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109142489) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-N-(3-acetylphenyl)-1-N-(2,6-diethylphenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-(3-acetylphenyl)-1-N-(2,6-diethylphenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109142489 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2-N-(3-acetylphenyl)-1-N-(2,6-diethylphenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C1CC1C(=O)Nc1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C23H26N2O3/c1-4-15-8-6-9-16(5-2)21(15)25-23(28)20-13-19(20)22(27)24-18-11-7-10-17(12-18)14(3)26/h6-12,19-20H,4-5,13H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | CFZVGMRMSFUSLP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |