C16H20O2Se — CID 10914274
(3S,3aR,6R,7aS)-3,6-dimethyl-3-phenylselanyl-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one (PubChem CID 10914274) has the molecular formula C16H20O2Se and a molecular weight of 323.29 g/mol. Its IUPAC name is (3S,3aR,6R,7aS)-3,6-dimethyl-3-phenylselanyl-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one.
| Compound Name | (3S,3aR,6R,7aS)-3,6-dimethyl-3-phenylselanyl-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
|---|---|
| PubChem CID | 10914274 |
| Molecular Formula | C16H20O2Se |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | (3S,3aR,6R,7aS)-3,6-dimethyl-3-phenylselanyl-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
| SMILES | C[C@@H]1CC[C@@H]2[C@H](C1)OC(=O)[C@@]2(C)[Se]c1ccccc1 |
| InChI | InChI=1S/C16H20O2Se/c1-11-8-9-13-14(10-11)18-15(17)16(13,2)19-12-6-4-3-5-7-12/h3-7,11,13-14H,8-10H2,1-2H3/t11-,13-,14+,16+/m1/s1 |
| InChIKey | GYAKFRGIDPTILZ-UYHMYPTGSA-N |
| XLogP | 2.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|