C19H17ClN2O4 — CID 109142893
methyl 2-[[2-[(3-chlorophenyl)carbamoyl]cyclopropanecarbonyl]amino]benzoate (PubChem CID 109142893) has the molecular formula C19H17ClN2O4 and a molecular weight of 372.81 g/mol. Its IUPAC name is methyl 2-[[2-[(3-chlorophenyl)carbamoyl]cyclopropanecarbonyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[(3-chlorophenyl)carbamoyl]cyclopropanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109142893 |
| Molecular Formula | C19H17ClN2O4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | methyl 2-[[2-[(3-chlorophenyl)carbamoyl]cyclopropanecarbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C1CC1C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H17ClN2O4/c1-26-19(25)13-7-2-3-8-16(13)22-18(24)15-10-14(15)17(23)21-12-6-4-5-11(20)9-12/h2-9,14-15H,10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | NRIGLTHEIRNJCK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |