C18H37BO2Si — CID 10914326
tri(propan-2-yl)-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]silane (PubChem CID 10914326) has the molecular formula C18H37BO2Si and a molecular weight of 324.39 g/mol. Its IUPAC name is tri(propan-2-yl)-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]silane.
| Compound Name | tri(propan-2-yl)-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]silane |
|---|---|
| PubChem CID | 10914326 |
| Molecular Formula | C18H37BO2Si |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | tri(propan-2-yl)-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]silane |
| SMILES | CC(C)[Si](C/C=C/B1OC(C)(C)C(C)(C)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H37BO2Si/c1-14(2)22(15(3)4,16(5)6)13-11-12-19-20-17(7,8)18(9,10)21-19/h11-12,14-16H,13H2,1-10H3/b12-11+ |
| InChIKey | GXHASGAFUKFEKC-VAWYXSNFSA-N |
| XLogP | 5.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|