C22H32Si — CID 10914335
bis(2,4,5,6,7,8-hexahydroazulen-2-yl)-dimethylsilane (PubChem CID 10914335) has the molecular formula C22H32Si and a molecular weight of 324.58 g/mol. Its IUPAC name is bis(2,4,5,6,7,8-hexahydroazulen-2-yl)-dimethylsilane.
| Compound Name | bis(2,4,5,6,7,8-hexahydroazulen-2-yl)-dimethylsilane |
|---|---|
| PubChem CID | 10914335 |
| Molecular Formula | C22H32Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | bis(2,4,5,6,7,8-hexahydroazulen-2-yl)-dimethylsilane |
| SMILES | C[Si](C)(C1C=C2CCCCCC2=C1)C1C=C2CCCCCC2=C1 |
| InChI | InChI=1S/C22H32Si/c1-23(2,21-13-17-9-5-3-6-10-18(17)14-21)22-15-19-11-7-4-8-12-20(19)16-22/h13-16,21-22H,3-12H2,1-2H3 |
| InChIKey | LXYHUSHNWGBXCC-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|