C19H17N3O3 — CID 109143462
1-N-(3-cyanophenyl)-2-N-(4-methoxyphenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109143462) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 1-N-(3-cyanophenyl)-2-N-(4-methoxyphenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(3-cyanophenyl)-2-N-(4-methoxyphenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109143462 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 1-N-(3-cyanophenyl)-2-N-(4-methoxyphenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | COc1ccc(NC(=O)C2CC2C(=O)Nc2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C19H17N3O3/c1-25-15-7-5-13(6-8-15)21-18(23)16-10-17(16)19(24)22-14-4-2-3-12(9-14)11-20/h2-9,16-17H,10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | KTIMXSPWXGZMLR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |