C19H18Cl2N2O3 — CID 109143544
1-N-(2,3-dichlorophenyl)-2-N-(4-ethoxyphenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109143544) has the molecular formula C19H18Cl2N2O3 and a molecular weight of 393.27 g/mol. Its IUPAC name is 1-N-(2,3-dichlorophenyl)-2-N-(4-ethoxyphenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(2,3-dichlorophenyl)-2-N-(4-ethoxyphenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109143544 |
| Molecular Formula | C19H18Cl2N2O3 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 1-N-(2,3-dichlorophenyl)-2-N-(4-ethoxyphenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)C2CC2C(=O)Nc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C19H18Cl2N2O3/c1-2-26-12-8-6-11(7-9-12)22-18(24)13-10-14(13)19(25)23-16-5-3-4-15(20)17(16)21/h3-9,13-14H,2,10H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | OCHJVVJMEWWUGX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |