C17H26O4S — CID 10914383
[5-(3,3-dimethyloxiran-2-yl)-3-methylpentyl] 4-methylbenzenesulfonate (PubChem CID 10914383) has the molecular formula C17H26O4S and a molecular weight of 326.46 g/mol. Its IUPAC name is [5-(3,3-dimethyloxiran-2-yl)-3-methylpentyl] 4-methylbenzenesulfonate.
| Compound Name | [5-(3,3-dimethyloxiran-2-yl)-3-methylpentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10914383 |
| Molecular Formula | C17H26O4S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | [5-(3,3-dimethyloxiran-2-yl)-3-methylpentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC(C)CCC2OC2(C)C)cc1 |
| InChI | InChI=1S/C17H26O4S/c1-13-5-8-15(9-6-13)22(18,19)20-12-11-14(2)7-10-16-17(3,4)21-16/h5-6,8-9,14,16H,7,10-12H2,1-4H3 |
| InChIKey | BVSYWZZEOXMFJY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|