C21H26N4O2 — CID 109143918
1-N,2-N-bis[4-(dimethylamino)phenyl]cyclopropane-1,2-dicarboxamide (PubChem CID 109143918) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 1-N,2-N-bis[4-(dimethylamino)phenyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-bis[4-(dimethylamino)phenyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109143918 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 1-N,2-N-bis[4-(dimethylamino)phenyl]cyclopropane-1,2-dicarboxamide |
| SMILES | CN(C)c1ccc(NC(=O)C2CC2C(=O)Nc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H26N4O2/c1-24(2)16-9-5-14(6-10-16)22-20(26)18-13-19(18)21(27)23-15-7-11-17(12-8-15)25(3)4/h5-12,18-19H,13H2,1-4H3,(H,22,26)(H,23,27) |
| InChIKey | KGGAHYFZCOLJAD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|