C24H30N2O3 — CID 109144415
4-N-(4-phenylmethoxyphenyl)-1-N-propylcyclohexane-1,4-dicarboxamide (PubChem CID 109144415) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 4-N-(4-phenylmethoxyphenyl)-1-N-propylcyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(4-phenylmethoxyphenyl)-1-N-propylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109144415 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 4-N-(4-phenylmethoxyphenyl)-1-N-propylcyclohexane-1,4-dicarboxamide |
| SMILES | CCCNC(=O)C1CCC(C(=O)Nc2ccc(OCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C24H30N2O3/c1-2-16-25-23(27)19-8-10-20(11-9-19)24(28)26-21-12-14-22(15-13-21)29-17-18-6-4-3-5-7-18/h3-7,12-15,19-20H,2,8-11,16-17H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | BWMNFXNYFZVGEE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |