About 1-N,4-N-dicyclopropylcyclohexane-1,4-dicarboxamide
1-N,4-N-dicyclopropylcyclohexane-1,4-dicarboxamide (PubChem CID 109144646) has the molecular formula C14H22N2O2
and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-N,4-N-dicyclopropylcyclohexane-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 1-N,4-N-dicyclopropylcyclohexane-1,4-dicarboxamide |
| PubChem CID | 109144646 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-N,4-N-dicyclopropylcyclohexane-1,4-dicarboxamide |
| SMILES | O=C(NC1CC1)C1CCC(C(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C14H22N2O2/c17-13(15-11-5-6-11)9-1-2-10(4-3-9)14(18)16-12-7-8-12/h9-12H,1-8H2,(H,15,17)(H,16,18) |
| InChIKey | IURBMCQZBWASJM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-N,4-N-dicyclopropylcyclohexane-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,4-N-dicyclopropylcyclohexane-1,4-dicarboxamide?
The IUPAC name of 1-N,4-N-dicyclopropylcyclohexane-1,4-dicarboxamide (CID 109144646) is 1-N,4-N-dicyclopropylcyclohexane-1,4-dicarboxamide.
What is the SMILES notation for 1-N,4-N-dicyclopropylcyclohexane-1,4-dicarboxamide?
The canonical SMILES for 1-N,4-N-dicyclopropylcyclohexane-1,4-dicarboxamide is O=C(NC1CC1)C1CCC(C(=O)NC2CC2)CC1.
What is the InChIKey of 1-N,4-N-dicyclopropylcyclohexane-1,4-dicarboxamide?
The InChIKey is IURBMCQZBWASJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O2/c17-13(15-11-5-6-11)9-1-2-10(4-3-9)14(18)16-12-7-8-12/h9-12H,1-8H2,(H,15,17)(H,16,18).
What are the key properties of 1-N,4-N-dicyclopropylcyclohexane-1,4-dicarboxamide?
1-N,4-N-dicyclopropylcyclohexane-1,4-dicarboxamide has a molecular weight of 250.34 g/mol, XLogP of 1.35, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,4-N-dicyclopropylcyclohexane-1,4-dicarboxamide is sourced from PubChem (CID 109144646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).