C14H19NO6S — CID 10914467
4-methyl-N-[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]benzenesulfonamide (PubChem CID 10914467) has the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. Its IUPAC name is 4-methyl-N-[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10914467 |
| Molecular Formula | C14H19NO6S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 4-methyl-N-[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H]2C=C(CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C14H19NO6S/c1-8-2-4-10(5-3-8)22(20,21)15-11-6-9(7-16)12(17)14(19)13(11)18/h2-6,11-19H,7H2,1H3/t11-,12+,13-,14-/m0/s1 |
| InChIKey | RTEUQVDWMVPSON-CRWXNKLISA-N |
| XLogP | -1.34 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|