C23H23NO — CID 10914479
7,7-dimethyl-2,4-diphenyl-1,4,6,8-tetrahydroquinolin-5-one (PubChem CID 10914479) has the molecular formula C23H23NO and a molecular weight of 329.44 g/mol. Its IUPAC name is 7,7-dimethyl-2,4-diphenyl-1,4,6,8-tetrahydroquinolin-5-one.
| Compound Name | 7,7-dimethyl-2,4-diphenyl-1,4,6,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 10914479 |
| Molecular Formula | C23H23NO |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 7,7-dimethyl-2,4-diphenyl-1,4,6,8-tetrahydroquinolin-5-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC(c1ccccc1)=CC2c1ccccc1 |
| InChI | InChI=1S/C23H23NO/c1-23(2)14-20-22(21(25)15-23)18(16-9-5-3-6-10-16)13-19(24-20)17-11-7-4-8-12-17/h3-13,18,24H,14-15H2,1-2H3 |
| InChIKey | DCKQOTCYLKBLLM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |