C17H18NO2PS — CID 10914531
(2R,4S)-4-diphenylphosphinothioylpyrrolidine-2-carboxylic acid (PubChem CID 10914531) has the molecular formula C17H18NO2PS and a molecular weight of 331.38 g/mol. Its IUPAC name is (2R,4S)-4-diphenylphosphinothioylpyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4S)-4-diphenylphosphinothioylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 10914531 |
| Molecular Formula | C17H18NO2PS |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | (2R,4S)-4-diphenylphosphinothioylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@H](P(=S)(c2ccccc2)c2ccccc2)CN1 |
| InChI | InChI=1S/C17H18NO2PS/c19-17(20)16-11-15(12-18-16)21(22,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-16,18H,11-12H2,(H,19,20)/t15-,16+/m0/s1 |
| InChIKey | LNXAUTNYDCSEHA-JKSUJKDBSA-N |
| XLogP | 1.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|