About methyl 2-acetamido-3-(1-methylindol-3-yl)(1,2-13C2)heptanoate
methyl 2-acetamido-3-(1-methylindol-3-yl)(1,2-13C2)heptanoate (PubChem CID 10914557) has the molecular formula C19H26N2O3
and a molecular weight of 332.41 g/mol. Its IUPAC name is methyl 2-acetamido-3-(1-methylindol-3-yl)(1,2-13C2)heptanoate.
Molecular Properties
| Compound Name | methyl 2-acetamido-3-(1-methylindol-3-yl)(1,2-13C2)heptanoate |
| PubChem CID | 10914557 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | methyl 2-acetamido-3-(1-methylindol-3-yl)(1,2-13C2)heptanoate |
| SMILES | CCCCC(c1cn(C)c2ccccc12)[13CH](NC(C)=O)[13C](=O)OC |
| InChI | InChI=1S/C19H26N2O3/c1-5-6-9-15(18(19(23)24-4)20-13(2)22)16-12-21(3)17-11-8-7-10-14(16)17/h7-8,10-12,15,18H,5-6,9H2,1-4H3,(H,20,22)/i18+1,19+1 |
| InChIKey | MLKUJXNDVWFTBB-DKKWJPBBSA-N |
| XLogP | 3.13 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-acetamido-3-(1-methylindol-3-yl)(1,2-13C2)heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-acetamido-3-(1-methylindol-3-yl)(1,2-13C2)heptanoate?
The IUPAC name of methyl 2-acetamido-3-(1-methylindol-3-yl)(1,2-13C2)heptanoate (CID 10914557) is methyl 2-acetamido-3-(1-methylindol-3-yl)(1,2-13C2)heptanoate.
What is the SMILES notation for methyl 2-acetamido-3-(1-methylindol-3-yl)(1,2-13C2)heptanoate?
The canonical SMILES for methyl 2-acetamido-3-(1-methylindol-3-yl)(1,2-13C2)heptanoate is CCCCC(c1cn(C)c2ccccc12)[13CH](NC(C)=O)[13C](=O)OC.
What is the InChIKey of methyl 2-acetamido-3-(1-methylindol-3-yl)(1,2-13C2)heptanoate?
The InChIKey is MLKUJXNDVWFTBB-DKKWJPBBSA-N. The full InChI is InChI=1S/C19H26N2O3/c1-5-6-9-15(18(19(23)24-4)20-13(2)22)16-12-21(3)17-11-8-7-10-14(16)17/h7-8,10-12,15,18H,5-6,9H2,1-4H3,(H,20,22)/i18+1,19+1.
What are the key properties of methyl 2-acetamido-3-(1-methylindol-3-yl)(1,2-13C2)heptanoate?
methyl 2-acetamido-3-(1-methylindol-3-yl)(1,2-13C2)heptanoate has a molecular weight of 332.41 g/mol, XLogP of 3.13, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetamido-3-(1-methylindol-3-yl)(1,2-13C2)heptanoate is sourced from PubChem (CID 10914557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).