C22H32N2O2 — CID 109145846
1-N-cyclopentyl-4-N-(2-ethyl-6-methylphenyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109145846) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 1-N-cyclopentyl-4-N-(2-ethyl-6-methylphenyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N-cyclopentyl-4-N-(2-ethyl-6-methylphenyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109145846 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 1-N-cyclopentyl-4-N-(2-ethyl-6-methylphenyl)cyclohexane-1,4-dicarboxamide |
| SMILES | CCc1cccc(C)c1NC(=O)C1CCC(C(=O)NC2CCCC2)CC1 |
| InChI | InChI=1S/C22H32N2O2/c1-3-16-8-6-7-15(2)20(16)24-22(26)18-13-11-17(12-14-18)21(25)23-19-9-4-5-10-19/h6-8,17-19H,3-5,9-14H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | NRJCXXGABQSRQV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |