C22H39NO — CID 10914594
Pyrrolidine, 1-(1-oxo-2,4-octadecadienyl)-, (E,E)- (PubChem CID 10914594) has the molecular formula C22H39NO and a molecular weight of 333.60 g/mol. Its IUPAC name is (2E,4E)-1-pyrrolidin-1-yloctadeca-2,4-dien-1-one.
| Compound Name | Pyrrolidine, 1-(1-oxo-2,4-octadecadienyl)-, (E,E)- |
|---|---|
| PubChem CID | 10914594 |
| Molecular Formula | C22H39NO |
| Molecular Weight | 333.60 g/mol |
| Exact Mass | 333.30 |
| IUPAC Name | (2E,4E)-1-pyrrolidin-1-yloctadeca-2,4-dien-1-one |
| SMILES | CCCCCCCCCCCCC/C=C/C=C/C(=O)N1CCCC1 |
| InChI | InChI=1S/C22H39NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-22(24)23-20-17-18-21-23/h14-16,19H,2-13,17-18,20-21H2,1H3/b15-14+,19-16+ |
| InChIKey | AVSSMWIINDFJMN-VNXILKCPSA-N |
| XLogP | 8.10 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | 353 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.60 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|