C18H28O6 — CID 10914772
ethyl (3'aR,4R,5S,7'aR)-2,2,4',4',7'a-pentamethyl-2'-oxospiro[1,3-dioxolane-5,5'-3,3a,6,7-tetrahydro-1-benzofuran]-4-carboxylate (PubChem CID 10914772) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is ethyl (3'aR,4R,5S,7'aR)-2,2,4',4',7'a-pentamethyl-2'-oxospiro[1,3-dioxolane-5,5'-3,3a,6,7-tetrahydro-1-benzofuran]-4-carboxylate.
| Compound Name | ethyl (3'aR,4R,5S,7'aR)-2,2,4',4',7'a-pentamethyl-2'-oxospiro[1,3-dioxolane-5,5'-3,3a,6,7-tetrahydro-1-benzofuran]-4-carboxylate |
|---|---|
| PubChem CID | 10914772 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | ethyl (3'aR,4R,5S,7'aR)-2,2,4',4',7'a-pentamethyl-2'-oxospiro[1,3-dioxolane-5,5'-3,3a,6,7-tetrahydro-1-benzofuran]-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1OC(C)(C)O[C@]12CC[C@@]1(C)OC(=O)C[C@@H]1C2(C)C |
| InChI | InChI=1S/C18H28O6/c1-7-21-14(20)13-18(24-16(4,5)23-13)9-8-17(6)11(15(18,2)3)10-12(19)22-17/h11,13H,7-10H2,1-6H3/t11-,13+,17-,18-/m1/s1 |
| InChIKey | CPZSRPHMKZAYTF-CWMCZYRISA-N |
| XLogP | 2.58 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |