C22H30O3 — CID 10914853
(4aS,6aS,12bS)-10-methoxy-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6-hexahydrobenzo[a]xanthen-9-ol (PubChem CID 10914853) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (4aS,6aS,12bS)-10-methoxy-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6-hexahydrobenzo[a]xanthen-9-ol.
| Compound Name | (4aS,6aS,12bS)-10-methoxy-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6-hexahydrobenzo[a]xanthen-9-ol |
|---|---|
| PubChem CID | 10914853 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (4aS,6aS,12bS)-10-methoxy-4,4,6a,12b-tetramethyl-1,2,3,4a,5,6-hexahydrobenzo[a]xanthen-9-ol |
| SMILES | COc1cc2c(cc1O)O[C@@]1(C)CC[C@H]3C(C)(C)CCC[C@]3(C)C1=C2 |
| InChI | InChI=1S/C22H30O3/c1-20(2)8-6-9-21(3)18(20)7-10-22(4)19(21)12-14-11-17(24-5)15(23)13-16(14)25-22/h11-13,18,23H,6-10H2,1-5H3/t18-,21-,22-/m0/s1 |
| InChIKey | BUIFJDSTUGQXPL-NYVOZVTQSA-N |
| XLogP | 5.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |