C23H36N2O2 — CID 109148640
1-N-benzyl-1-N-ethyl-4-N,4-N-dipropylcyclohexane-1,4-dicarboxamide (PubChem CID 109148640) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is 1-N-benzyl-1-N-ethyl-4-N,4-N-dipropylcyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N-benzyl-1-N-ethyl-4-N,4-N-dipropylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109148640 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | 1-N-benzyl-1-N-ethyl-4-N,4-N-dipropylcyclohexane-1,4-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1CCC(C(=O)N(CC)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H36N2O2/c1-4-16-25(17-5-2)23(27)21-14-12-20(13-15-21)22(26)24(6-3)18-19-10-8-7-9-11-19/h7-11,20-21H,4-6,12-18H2,1-3H3 |
| InChIKey | JSHOAMOERBEJCF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |