C18H36O4Si — CID 10914923
methyl (E,5S,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-3,5,7-trimethyloct-2-enoate (PubChem CID 10914923) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is methyl (E,5S,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-3,5,7-trimethyloct-2-enoate.
| Compound Name | methyl (E,5S,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-3,5,7-trimethyloct-2-enoate |
|---|---|
| PubChem CID | 10914923 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | methyl (E,5S,6R,7R)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-3,5,7-trimethyloct-2-enoate |
| SMILES | COC(=O)/C=C(\C)C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CO |
| InChI | InChI=1S/C18H36O4Si/c1-13(11-16(20)21-7)10-14(2)17(15(3)12-19)22-23(8,9)18(4,5)6/h11,14-15,17,19H,10,12H2,1-9H3/b13-11+/t14-,15+,17+/m0/s1 |
| InChIKey | TYIIDDCLDXGJJH-QPFFFOLQSA-N |
| XLogP | 4.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|