About 1-N-tert-butyl-4-N-ethyl-4-N-phenylcyclohexane-1,4-dicarboxamide
1-N-tert-butyl-4-N-ethyl-4-N-phenylcyclohexane-1,4-dicarboxamide (PubChem CID 109149575) has the molecular formula C20H30N2O2
and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-N-tert-butyl-4-N-ethyl-4-N-phenylcyclohexane-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 1-N-tert-butyl-4-N-ethyl-4-N-phenylcyclohexane-1,4-dicarboxamide |
| PubChem CID | 109149575 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 1-N-tert-butyl-4-N-ethyl-4-N-phenylcyclohexane-1,4-dicarboxamide |
| SMILES | CCN(C(=O)C1CCC(C(=O)NC(C)(C)C)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H30N2O2/c1-5-22(17-9-7-6-8-10-17)19(24)16-13-11-15(12-14-16)18(23)21-20(2,3)4/h6-10,15-16H,5,11-14H2,1-4H3,(H,21,23) |
| InChIKey | CUMMYMRQAXQRGR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-N-tert-butyl-4-N-ethyl-4-N-phenylcyclohexane-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-tert-butyl-4-N-ethyl-4-N-phenylcyclohexane-1,4-dicarboxamide?
The IUPAC name of 1-N-tert-butyl-4-N-ethyl-4-N-phenylcyclohexane-1,4-dicarboxamide (CID 109149575) is 1-N-tert-butyl-4-N-ethyl-4-N-phenylcyclohexane-1,4-dicarboxamide.
What is the SMILES notation for 1-N-tert-butyl-4-N-ethyl-4-N-phenylcyclohexane-1,4-dicarboxamide?
The canonical SMILES for 1-N-tert-butyl-4-N-ethyl-4-N-phenylcyclohexane-1,4-dicarboxamide is CCN(C(=O)C1CCC(C(=O)NC(C)(C)C)CC1)c1ccccc1.
What is the InChIKey of 1-N-tert-butyl-4-N-ethyl-4-N-phenylcyclohexane-1,4-dicarboxamide?
The InChIKey is CUMMYMRQAXQRGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N2O2/c1-5-22(17-9-7-6-8-10-17)19(24)16-13-11-15(12-14-16)18(23)21-20(2,3)4/h6-10,15-16H,5,11-14H2,1-4H3,(H,21,23).
What are the key properties of 1-N-tert-butyl-4-N-ethyl-4-N-phenylcyclohexane-1,4-dicarboxamide?
1-N-tert-butyl-4-N-ethyl-4-N-phenylcyclohexane-1,4-dicarboxamide has a molecular weight of 330.47 g/mol, XLogP of 3.76, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-tert-butyl-4-N-ethyl-4-N-phenylcyclohexane-1,4-dicarboxamide is sourced from PubChem (CID 109149575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).