C21H22F2N2O3 — CID 109151046
4-N-(2,6-difluorophenyl)-1-N-(3-methoxyphenyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109151046) has the molecular formula C21H22F2N2O3 and a molecular weight of 388.41 g/mol. Its IUPAC name is 4-N-(2,6-difluorophenyl)-1-N-(3-methoxyphenyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(2,6-difluorophenyl)-1-N-(3-methoxyphenyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109151046 |
| Molecular Formula | C21H22F2N2O3 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 4-N-(2,6-difluorophenyl)-1-N-(3-methoxyphenyl)cyclohexane-1,4-dicarboxamide |
| SMILES | COc1cccc(NC(=O)C2CCC(C(=O)Nc3c(F)cccc3F)CC2)c1 |
| InChI | InChI=1S/C21H22F2N2O3/c1-28-16-5-2-4-15(12-16)24-20(26)13-8-10-14(11-9-13)21(27)25-19-17(22)6-3-7-18(19)23/h2-7,12-14H,8-11H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | USKBPQQSOPNEKO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |