About [3-[(4-amino-2,5-dimethoxyphenyl)diazenyl]phenyl]-trimethylazanium
[3-[(4-amino-2,5-dimethoxyphenyl)diazenyl]phenyl]-trimethylazanium (PubChem CID 10915114) has the molecular formula C17H23N4O2+
and a molecular weight of 315.40 g/mol. Its IUPAC name is [3-[(4-amino-2,5-dimethoxyphenyl)diazenyl]phenyl]-trimethylazanium.
Molecular Properties
| Compound Name | [3-[(4-amino-2,5-dimethoxyphenyl)diazenyl]phenyl]-trimethylazanium |
| PubChem CID | 10915114 |
| Molecular Formula | C17H23N4O2+ |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | [3-[(4-amino-2,5-dimethoxyphenyl)diazenyl]phenyl]-trimethylazanium |
| SMILES | COc1cc(/N=N/c2cccc([N+](C)(C)C)c2)c(OC)cc1N |
| InChI | InChI=1S/C17H23N4O2/c1-21(2,3)13-8-6-7-12(9-13)19-20-15-11-16(22-4)14(18)10-17(15)23-5/h6-11H,18H2,1-5H3/q+1/b20-19+ |
| InChIKey | KVOHWQOWTKJQQU-FMQUCBEESA-N |
| XLogP | 3.90 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [3-[(4-amino-2,5-dimethoxyphenyl)diazenyl]phenyl]-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(4-amino-2,5-dimethoxyphenyl)diazenyl]phenyl]-trimethylazanium?
The IUPAC name of [3-[(4-amino-2,5-dimethoxyphenyl)diazenyl]phenyl]-trimethylazanium (CID 10915114) is [3-[(4-amino-2,5-dimethoxyphenyl)diazenyl]phenyl]-trimethylazanium.
What is the SMILES notation for [3-[(4-amino-2,5-dimethoxyphenyl)diazenyl]phenyl]-trimethylazanium?
The canonical SMILES for [3-[(4-amino-2,5-dimethoxyphenyl)diazenyl]phenyl]-trimethylazanium is COc1cc(/N=N/c2cccc([N+](C)(C)C)c2)c(OC)cc1N.
What is the InChIKey of [3-[(4-amino-2,5-dimethoxyphenyl)diazenyl]phenyl]-trimethylazanium?
The InChIKey is KVOHWQOWTKJQQU-FMQUCBEESA-N. The full InChI is InChI=1S/C17H23N4O2/c1-21(2,3)13-8-6-7-12(9-13)19-20-15-11-16(22-4)14(18)10-17(15)23-5/h6-11H,18H2,1-5H3/q+1/b20-19+.
What are the key properties of [3-[(4-amino-2,5-dimethoxyphenyl)diazenyl]phenyl]-trimethylazanium?
[3-[(4-amino-2,5-dimethoxyphenyl)diazenyl]phenyl]-trimethylazanium has a molecular weight of 315.40 g/mol, XLogP of 3.90, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(4-amino-2,5-dimethoxyphenyl)diazenyl]phenyl]-trimethylazanium is sourced from PubChem (CID 10915114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).