About N,N-dimethyl-4-[1-(3,4,5-trimethoxyphenyl)imidazol-2-yl]aniline
N,N-dimethyl-4-[1-(3,4,5-trimethoxyphenyl)imidazol-2-yl]aniline (PubChem CID 10915201) has the molecular formula C20H23N3O3
and a molecular weight of 353.42 g/mol. Its IUPAC name is N,N-dimethyl-4-[1-(3,4,5-trimethoxyphenyl)imidazol-2-yl]aniline.
Molecular Properties
| Compound Name | N,N-dimethyl-4-[1-(3,4,5-trimethoxyphenyl)imidazol-2-yl]aniline |
| PubChem CID | 10915201 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N,N-dimethyl-4-[1-(3,4,5-trimethoxyphenyl)imidazol-2-yl]aniline |
| SMILES | COc1cc(-n2ccnc2-c2ccc(N(C)C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H23N3O3/c1-22(2)15-8-6-14(7-9-15)20-21-10-11-23(20)16-12-17(24-3)19(26-5)18(13-16)25-4/h6-13H,1-5H3 |
| InChIKey | CSHQIZPZRMFTEL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-4-[1-(3,4,5-trimethoxyphenyl)imidazol-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-4-[1-(3,4,5-trimethoxyphenyl)imidazol-2-yl]aniline?
The IUPAC name of N,N-dimethyl-4-[1-(3,4,5-trimethoxyphenyl)imidazol-2-yl]aniline (CID 10915201) is N,N-dimethyl-4-[1-(3,4,5-trimethoxyphenyl)imidazol-2-yl]aniline.
What is the SMILES notation for N,N-dimethyl-4-[1-(3,4,5-trimethoxyphenyl)imidazol-2-yl]aniline?
The canonical SMILES for N,N-dimethyl-4-[1-(3,4,5-trimethoxyphenyl)imidazol-2-yl]aniline is COc1cc(-n2ccnc2-c2ccc(N(C)C)cc2)cc(OC)c1OC.
What is the InChIKey of N,N-dimethyl-4-[1-(3,4,5-trimethoxyphenyl)imidazol-2-yl]aniline?
The InChIKey is CSHQIZPZRMFTEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O3/c1-22(2)15-8-6-14(7-9-15)20-21-10-11-23(20)16-12-17(24-3)19(26-5)18(13-16)25-4/h6-13H,1-5H3.
What are the key properties of N,N-dimethyl-4-[1-(3,4,5-trimethoxyphenyl)imidazol-2-yl]aniline?
N,N-dimethyl-4-[1-(3,4,5-trimethoxyphenyl)imidazol-2-yl]aniline has a molecular weight of 353.42 g/mol, XLogP of 3.63, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-4-[1-(3,4,5-trimethoxyphenyl)imidazol-2-yl]aniline is sourced from PubChem (CID 10915201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).