C17H18BrN3O — CID 109152213
N-(3-bromophenyl)-6-(cyclopentylamino)pyridine-3-carboxamide (PubChem CID 109152213) has the molecular formula C17H18BrN3O and a molecular weight of 360.26 g/mol. Its IUPAC name is N-(3-bromophenyl)-6-(cyclopentylamino)pyridine-3-carboxamide.
| Compound Name | N-(3-bromophenyl)-6-(cyclopentylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109152213 |
| Molecular Formula | C17H18BrN3O |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-(3-bromophenyl)-6-(cyclopentylamino)pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(Br)c1)c1ccc(NC2CCCC2)nc1 |
| InChI | InChI=1S/C17H18BrN3O/c18-13-4-3-7-15(10-13)21-17(22)12-8-9-16(19-11-12)20-14-5-1-2-6-14/h3-4,7-11,14H,1-2,5-6H2,(H,19,20)(H,21,22) |
| InChIKey | AYLFWMKOWGVGHV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |