C18H24N4O — CID 109154437
N-[3-(dimethylamino)propyl]-6-(4-methylanilino)pyridine-3-carboxamide (PubChem CID 109154437) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-6-(4-methylanilino)pyridine-3-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-6-(4-methylanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109154437 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-6-(4-methylanilino)pyridine-3-carboxamide |
| SMILES | Cc1ccc(Nc2ccc(C(=O)NCCCN(C)C)cn2)cc1 |
| InChI | InChI=1S/C18H24N4O/c1-14-5-8-16(9-6-14)21-17-10-7-15(13-20-17)18(23)19-11-4-12-22(2)3/h5-10,13H,4,11-12H2,1-3H3,(H,19,23)(H,20,21) |
| InChIKey | MCADDJOMUNHGFD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|