C19H17N5OS — CID 10915454
N-[2-(6-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl)ethoxy]-1,1-diphenylmethanimine (PubChem CID 10915454) has the molecular formula C19H17N5OS and a molecular weight of 363.45 g/mol. Its IUPAC name is N-[2-(6-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl)ethoxy]-1,1-diphenylmethanimine.
| Compound Name | N-[2-(6-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl)ethoxy]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 10915454 |
| Molecular Formula | C19H17N5OS |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-[2-(6-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl)ethoxy]-1,1-diphenylmethanimine |
| SMILES | Cc1nn2c(CCON=C(c3ccccc3)c3ccccc3)nnc2s1 |
| InChI | InChI=1S/C19H17N5OS/c1-14-22-24-17(20-21-19(24)26-14)12-13-25-23-18(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11H,12-13H2,1H3 |
| InChIKey | DHZAEBIVUSVEQD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 64.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|