C18H22Cl2N2O2 — CID 10915605
4,5-dichloro-3,6-bis(3-methylbutoxy)benzene-1,2-dicarbonitrile (PubChem CID 10915605) has the molecular formula C18H22Cl2N2O2 and a molecular weight of 369.29 g/mol. Its IUPAC name is 4,5-dichloro-3,6-bis(3-methylbutoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 4,5-dichloro-3,6-bis(3-methylbutoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 10915605 |
| Molecular Formula | C18H22Cl2N2O2 |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 4,5-dichloro-3,6-bis(3-methylbutoxy)benzene-1,2-dicarbonitrile |
| SMILES | CC(C)CCOc1c(Cl)c(Cl)c(OCCC(C)C)c(C#N)c1C#N |
| InChI | InChI=1S/C18H22Cl2N2O2/c1-11(2)5-7-23-17-13(9-21)14(10-22)18(16(20)15(17)19)24-8-6-12(3)4/h11-12H,5-8H2,1-4H3 |
| InChIKey | RWELCPXAIDOYEZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |