About [(2R,3R)-2-benzoyloxy-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]methyl benzoate
[(2R,3R)-2-benzoyloxy-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]methyl benzoate (PubChem CID 10915607) has the molecular formula C20H19NO6
and a molecular weight of 369.37 g/mol. Its IUPAC name is [(2R,3R)-2-benzoyloxy-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]methyl benzoate.
Molecular Properties
| Compound Name | [(2R,3R)-2-benzoyloxy-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]methyl benzoate |
| PubChem CID | 10915607 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | [(2R,3R)-2-benzoyloxy-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]methyl benzoate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N(COC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19NO6/c1-13(22)16-17(23)21(12-26-19(24)14-8-4-2-5-9-14)18(16)27-20(25)15-10-6-3-7-11-15/h2-11,13,16,18,22H,12H2,1H3/t13-,16+,18-/m1/s1 |
| InChIKey | IBPNFBPGXOJOFQ-RPVQJOFSSA-N |
| XLogP | 1.82 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(2R,3R)-2-benzoyloxy-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-2-benzoyloxy-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]methyl benzoate?
The IUPAC name of [(2R,3R)-2-benzoyloxy-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]methyl benzoate (CID 10915607) is [(2R,3R)-2-benzoyloxy-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]methyl benzoate.
What is the SMILES notation for [(2R,3R)-2-benzoyloxy-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]methyl benzoate?
The canonical SMILES for [(2R,3R)-2-benzoyloxy-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]methyl benzoate is C[C@@H](O)[C@H]1C(=O)N(COC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1.
What is the InChIKey of [(2R,3R)-2-benzoyloxy-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]methyl benzoate?
The InChIKey is IBPNFBPGXOJOFQ-RPVQJOFSSA-N. The full InChI is InChI=1S/C20H19NO6/c1-13(22)16-17(23)21(12-26-19(24)14-8-4-2-5-9-14)18(16)27-20(25)15-10-6-3-7-11-15/h2-11,13,16,18,22H,12H2,1H3/t13-,16+,18-/m1/s1.
What are the key properties of [(2R,3R)-2-benzoyloxy-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]methyl benzoate?
[(2R,3R)-2-benzoyloxy-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]methyl benzoate has a molecular weight of 369.37 g/mol, XLogP of 1.82, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-2-benzoyloxy-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]methyl benzoate is sourced from PubChem (CID 10915607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).