C21H25NO5 — CID 10915658
methyl (2R)-3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-[(1R,2S)-2-ethenylcyclopentyl]-3-oxopropanoate (PubChem CID 10915658) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is methyl (2R)-3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-[(1R,2S)-2-ethenylcyclopentyl]-3-oxopropanoate.
| Compound Name | methyl (2R)-3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-[(1R,2S)-2-ethenylcyclopentyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 10915658 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | methyl (2R)-3-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-[(1R,2S)-2-ethenylcyclopentyl]-3-oxopropanoate |
| SMILES | C=C[C@@H]1CCC[C@H]1[C@@H](C(=O)OC)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C21H25NO5/c1-3-15-10-7-11-17(15)18(20(24)26-2)19(23)22-16(13-27-21(22)25)12-14-8-5-4-6-9-14/h3-6,8-9,15-18H,1,7,10-13H2,2H3/t15-,16+,17-,18-/m1/s1 |
| InChIKey | XYBLOXSXASLUOS-XMTFNYHQSA-N |
| XLogP | 2.97 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|