C20H23N3O3 — CID 109157408
azepan-1-yl-[6-(1,3-benzodioxol-5-ylmethylamino)-3-pyridinyl]methanone (PubChem CID 109157408) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is azepan-1-yl-[6-(1,3-benzodioxol-5-ylmethylamino)-3-pyridinyl]methanone.
| Compound Name | azepan-1-yl-[6-(1,3-benzodioxol-5-ylmethylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 109157408 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | azepan-1-yl-[6-(1,3-benzodioxol-5-ylmethylamino)-3-pyridinyl]methanone |
| SMILES | O=C(c1ccc(NCc2ccc3c(c2)OCO3)nc1)N1CCCCCC1 |
| InChI | InChI=1S/C20H23N3O3/c24-20(23-9-3-1-2-4-10-23)16-6-8-19(22-13-16)21-12-15-5-7-17-18(11-15)26-14-25-17/h5-8,11,13H,1-4,9-10,12,14H2,(H,21,22) |
| InChIKey | MBQKHZRRDDWSPL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |