C13H9BrF3NO4 — CID 10915881
2-[3-bromo-2-oxo-1-(2,2,2-trifluoroethoxy)propyl]isoindole-1,3-dione (PubChem CID 10915881) has the molecular formula C13H9BrF3NO4 and a molecular weight of 380.12 g/mol. Its IUPAC name is 2-[3-bromo-2-oxo-1-(2,2,2-trifluoroethoxy)propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-bromo-2-oxo-1-(2,2,2-trifluoroethoxy)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10915881 |
| Molecular Formula | C13H9BrF3NO4 |
| Molecular Weight | 380.12 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | 2-[3-bromo-2-oxo-1-(2,2,2-trifluoroethoxy)propyl]isoindole-1,3-dione |
| SMILES | O=C(CBr)C(OCC(F)(F)F)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H9BrF3NO4/c14-5-9(19)12(22-6-13(15,16)17)18-10(20)7-3-1-2-4-8(7)11(18)21/h1-4,12H,5-6H2 |
| InChIKey | ZZINADFXUALKGC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.12 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|