C23H24N4O2 — CID 109159643
[6-(3-methoxyanilino)-3-pyridinyl]-(4-phenylpiperazin-1-yl)methanone (PubChem CID 109159643) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is [6-(3-methoxyanilino)-3-pyridinyl]-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | [6-(3-methoxyanilino)-3-pyridinyl]-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109159643 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [6-(3-methoxyanilino)-3-pyridinyl]-(4-phenylpiperazin-1-yl)methanone |
| SMILES | COc1cccc(Nc2ccc(C(=O)N3CCN(c4ccccc4)CC3)cn2)c1 |
| InChI | InChI=1S/C23H24N4O2/c1-29-21-9-5-6-19(16-21)25-22-11-10-18(17-24-22)23(28)27-14-12-26(13-15-27)20-7-3-2-4-8-20/h2-11,16-17H,12-15H2,1H3,(H,24,25) |
| InChIKey | DZMOQGYNAAZGTR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |