C23H33NO4 — CID 10916075
(1S,3S,7S,9R)-3-[3-(1,3-dioxolan-2-yl)propyl]-1-methoxy-9-phenyl-11-oxa-8-azatricyclo[5.4.1.03,8]dodecane (PubChem CID 10916075) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is (1S,3S,7S,9R)-3-[3-(1,3-dioxolan-2-yl)propyl]-1-methoxy-9-phenyl-11-oxa-8-azatricyclo[5.4.1.03,8]dodecane.
| Compound Name | (1S,3S,7S,9R)-3-[3-(1,3-dioxolan-2-yl)propyl]-1-methoxy-9-phenyl-11-oxa-8-azatricyclo[5.4.1.03,8]dodecane |
|---|---|
| PubChem CID | 10916075 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | (1S,3S,7S,9R)-3-[3-(1,3-dioxolan-2-yl)propyl]-1-methoxy-9-phenyl-11-oxa-8-azatricyclo[5.4.1.03,8]dodecane |
| SMILES | CO[C@]12C[C@@H]3CCC[C@](CCCC4OCCO4)(C1)N3[C@H](c1ccccc1)CO2 |
| InChI | InChI=1S/C23H33NO4/c1-25-23-15-19-9-5-11-22(17-23,12-6-10-21-26-13-14-27-21)24(19)20(16-28-23)18-7-3-2-4-8-18/h2-4,7-8,19-21H,5-6,9-17H2,1H3/t19-,20-,22-,23-/m0/s1 |
| InChIKey | VYFHJVRGIDXSPY-SQOUVECCSA-N |
| XLogP | 4.03 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |