C17H29Cl2N5O — CID 10916139
N-butyl-4,6-dichloro-N-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine (PubChem CID 10916139) has the molecular formula C17H29Cl2N5O and a molecular weight of 390.36 g/mol. Its IUPAC name is N-butyl-4,6-dichloro-N-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-butyl-4,6-dichloro-N-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 10916139 |
| Molecular Formula | C17H29Cl2N5O |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-butyl-4,6-dichloro-N-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine |
| SMILES | CCCCN(c1nc(Cl)nc(Cl)n1)C1CC(C)(C)N(OC)C(C)(C)C1 |
| InChI | InChI=1S/C17H29Cl2N5O/c1-7-8-9-23(15-21-13(18)20-14(19)22-15)12-10-16(2,3)24(25-6)17(4,5)11-12/h12H,7-11H2,1-6H3 |
| InChIKey | HXZCYCANLMOPBM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |