C19H23N3O3 — CID 109161569
methyl 2-[[5-[butyl(methyl)carbamoyl]-2-pyridinyl]amino]benzoate (PubChem CID 109161569) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is methyl 2-[[5-[butyl(methyl)carbamoyl]-2-pyridinyl]amino]benzoate.
| Compound Name | methyl 2-[[5-[butyl(methyl)carbamoyl]-2-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 109161569 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | methyl 2-[[5-[butyl(methyl)carbamoyl]-2-pyridinyl]amino]benzoate |
| SMILES | CCCCN(C)C(=O)c1ccc(Nc2ccccc2C(=O)OC)nc1 |
| InChI | InChI=1S/C19H23N3O3/c1-4-5-12-22(2)18(23)14-10-11-17(20-13-14)21-16-9-7-6-8-15(16)19(24)25-3/h6-11,13H,4-5,12H2,1-3H3,(H,20,21) |
| InChIKey | FEWMIBGHFSVVQF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |