About carbon monoxide;N-[(1S)-1-(2-chlorophenyl)but-3-enyl]aniline;chromium
carbon monoxide;N-[(1S)-1-(2-chlorophenyl)but-3-enyl]aniline;chromium (PubChem CID 10916215) has the molecular formula C19H16ClCrNO3
and a molecular weight of 393.79 g/mol. Its IUPAC name is carbon monoxide;N-[(1S)-1-(2-chlorophenyl)but-3-enyl]aniline;chromium.
Molecular Properties
| Compound Name | carbon monoxide;N-[(1S)-1-(2-chlorophenyl)but-3-enyl]aniline;chromium |
| PubChem CID | 10916215 |
| Molecular Formula | C19H16ClCrNO3 |
| Molecular Weight | 393.79 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | carbon monoxide;N-[(1S)-1-(2-chlorophenyl)but-3-enyl]aniline;chromium |
| SMILES | C=CC[C@H](Nc1ccccc1)c1ccccc1Cl.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C16H16ClN.3CO.Cr/c1-2-8-16(14-11-6-7-12-15(14)17)18-13-9-4-3-5-10-13;3*1-2;/h2-7,9-12,16,18H,1,8H2;;;;/t16-;;;;/m0..../s1 |
| InChIKey | JZKJBVGTFBGWNR-FXAGWRDUSA-N |
| XLogP | 4.95 |
| TPSA | 71.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.79 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;N-[(1S)-1-(2-chlorophenyl)but-3-enyl]aniline;chromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;N-[(1S)-1-(2-chlorophenyl)but-3-enyl]aniline;chromium?
The IUPAC name of carbon monoxide;N-[(1S)-1-(2-chlorophenyl)but-3-enyl]aniline;chromium (CID 10916215) is carbon monoxide;N-[(1S)-1-(2-chlorophenyl)but-3-enyl]aniline;chromium.
What is the SMILES notation for carbon monoxide;N-[(1S)-1-(2-chlorophenyl)but-3-enyl]aniline;chromium?
The canonical SMILES for carbon monoxide;N-[(1S)-1-(2-chlorophenyl)but-3-enyl]aniline;chromium is C=CC[C@H](Nc1ccccc1)c1ccccc1Cl.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr].
What is the InChIKey of carbon monoxide;N-[(1S)-1-(2-chlorophenyl)but-3-enyl]aniline;chromium?
The InChIKey is JZKJBVGTFBGWNR-FXAGWRDUSA-N. The full InChI is InChI=1S/C16H16ClN.3CO.Cr/c1-2-8-16(14-11-6-7-12-15(14)17)18-13-9-4-3-5-10-13;3*1-2;/h2-7,9-12,16,18H,1,8H2;;;;/t16-;;;;/m0..../s1.
What are the key properties of carbon monoxide;N-[(1S)-1-(2-chlorophenyl)but-3-enyl]aniline;chromium?
carbon monoxide;N-[(1S)-1-(2-chlorophenyl)but-3-enyl]aniline;chromium has a molecular weight of 393.79 g/mol, XLogP of 4.95, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;N-[(1S)-1-(2-chlorophenyl)but-3-enyl]aniline;chromium is sourced from PubChem (CID 10916215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).