C20H14F5NO2 — CID 10916248
[(E)-(2-prop-2-enyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] 2,3,4,5,6-pentafluorobenzoate (PubChem CID 10916248) has the molecular formula C20H14F5NO2 and a molecular weight of 395.33 g/mol. Its IUPAC name is [(E)-(2-prop-2-enyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | [(E)-(2-prop-2-enyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 10916248 |
| Molecular Formula | C20H14F5NO2 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | [(E)-(2-prop-2-enyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] 2,3,4,5,6-pentafluorobenzoate |
| SMILES | C=CCC1CCc2ccccc2/C1=N/OC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H14F5NO2/c1-2-5-11-9-8-10-6-3-4-7-12(10)19(11)26-28-20(27)13-14(21)16(23)18(25)17(24)15(13)22/h2-4,6-7,11H,1,5,8-9H2/b26-19+ |
| InChIKey | FAOCBVGECCBURB-LGUFXXKBSA-N |
| XLogP | 5.08 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|