C23H23N3O2 — CID 109162480
6-(3,4-dihydro-2H-quinolin-1-yl)-N-(4-ethoxyphenyl)pyridine-3-carboxamide (PubChem CID 109162480) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 6-(3,4-dihydro-2H-quinolin-1-yl)-N-(4-ethoxyphenyl)pyridine-3-carboxamide.
| Compound Name | 6-(3,4-dihydro-2H-quinolin-1-yl)-N-(4-ethoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109162480 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 6-(3,4-dihydro-2H-quinolin-1-yl)-N-(4-ethoxyphenyl)pyridine-3-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(N3CCCc4ccccc43)nc2)cc1 |
| InChI | InChI=1S/C23H23N3O2/c1-2-28-20-12-10-19(11-13-20)25-23(27)18-9-14-22(24-16-18)26-15-5-7-17-6-3-4-8-21(17)26/h3-4,6,8-14,16H,2,5,7,15H2,1H3,(H,25,27) |
| InChIKey | KWRGCIWBQZJFRY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |