C22H44O2Si2 — CID 10916284
tert-butyl-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenyl-2-ethylhex-5-ynoxy]-dimethylsilane (PubChem CID 10916284) has the molecular formula C22H44O2Si2 and a molecular weight of 396.76 g/mol. Its IUPAC name is tert-butyl-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenyl-2-ethylhex-5-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenyl-2-ethylhex-5-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10916284 |
| Molecular Formula | C22H44O2Si2 |
| Molecular Weight | 396.76 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | tert-butyl-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenyl-2-ethylhex-5-ynoxy]-dimethylsilane |
| SMILES | C#CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CC)[C@@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O2Si2/c1-14-17-20(24-26(12,13)22(7,8)9)18(15-2)19(16-3)23-25(10,11)21(4,5)6/h1,16,18-20H,3,15,17H2,2,4-13H3/t18-,19-,20-/m1/s1 |
| InChIKey | WUFFRDKGNODSLR-VAMGGRTRSA-N |
| XLogP | 7.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.76 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|