C19H18Cl3NO2 — CID 10916338
(1,1,1-trichloro-2-methylpropan-2-yl) (2R,3R)-2,3-diphenylaziridine-1-carboxylate (PubChem CID 10916338) has the molecular formula C19H18Cl3NO2 and a molecular weight of 398.72 g/mol. Its IUPAC name is (1,1,1-trichloro-2-methylpropan-2-yl) (2R,3R)-2,3-diphenylaziridine-1-carboxylate.
| Compound Name | (1,1,1-trichloro-2-methylpropan-2-yl) (2R,3R)-2,3-diphenylaziridine-1-carboxylate |
|---|---|
| PubChem CID | 10916338 |
| Molecular Formula | C19H18Cl3NO2 |
| Molecular Weight | 398.72 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | (1,1,1-trichloro-2-methylpropan-2-yl) (2R,3R)-2,3-diphenylaziridine-1-carboxylate |
| SMILES | CC(C)(OC(=O)N1[C@H](c2ccccc2)[C@H]1c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H18Cl3NO2/c1-18(2,19(20,21)22)25-17(24)23-15(13-9-5-3-6-10-13)16(23)14-11-7-4-8-12-14/h3-12,15-16H,1-2H3/t15-,16-/m1/s1 |
| InChIKey | VHSHPJWPQXLZRE-HZPDHXFCSA-N |
| XLogP | 6.07 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.72 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|